C28H35N5O2 — CID 87331269
1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)-7-pyridin-2-ylheptyl]piperidine-4-carboxamide (PubChem CID 87331269) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)-7-pyridin-2-ylheptyl]piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)-7-pyridin-2-ylheptyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87331269 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)-7-pyridin-2-ylheptyl]piperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)N[C@@H](CCCCCC(=O)c2ccccn2)c2ncc(-c3ccccc3)[nH]2)CC1 |
| InChI | InChI=1S/C28H35N5O2/c1-33-18-15-22(16-19-33)28(35)32-24(27-30-20-25(31-27)21-10-4-2-5-11-21)13-6-3-7-14-26(34)23-12-8-9-17-29-23/h2,4-5,8-12,17,20,22,24H,3,6-7,13-16,18-19H2,1H3,(H,30,31)(H,32,35)/t24-/m0/s1 |
| InChIKey | NBHIUHBQRKSJFW-DEOSSOPVSA-N |
| XLogP | 4.80 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|