C30H30F3N5O5S — CID 87331353
(7S)-7-[(4-cyanophenyl)sulfonylamino]-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanamide;2,2,2-trifluoroacetate (PubChem CID 87331353) has the molecular formula C30H30F3N5O5S and a molecular weight of 629.66 g/mol. Its IUPAC name is (7S)-7-[(4-cyanophenyl)sulfonylamino]-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanamide;2,2,2-trifluoroacetate.
| Compound Name | (7S)-7-[(4-cyanophenyl)sulfonylamino]-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331353 |
| Molecular Formula | C30H30F3N5O5S |
| Molecular Weight | 629.66 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | (7S)-7-[(4-cyanophenyl)sulfonylamino]-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanamide;2,2,2-trifluoroacetate |
| SMILES | CNC(=O)CCCCC[C@H](NS(=O)(=O)c1ccc(C#N)cc1)C1=NC=C(c2ccc3ccccc3c2)[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H29N5O3S.C2HF3O2/c1-30-27(34)10-4-2-3-9-25(33-37(35,36)24-15-11-20(18-29)12-16-24)28-31-19-26(32-28)23-14-13-21-7-5-6-8-22(21)17-23;3-2(4,5)1(6)7/h5-8,11-17,19,25,33H,2-4,9-10H2,1H3,(H,30,34)(H,31,32);(H,6,7)/t25-;/m0./s1 |
| InChIKey | LATVMJIGWLLVAY-UQIIZPHYSA-N |
| XLogP | 2.33 |
| TPSA | 168.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|