C29H34F6N6O6 — CID 87331428
1-methyl-N-[(1S)-7-oxo-1-(5-quinoxalin-2-yl-1H-imidazol-1-ium-2-yl)nonyl]azetidin-1-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87331428) has the molecular formula C29H34F6N6O6 and a molecular weight of 676.62 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-7-oxo-1-(5-quinoxalin-2-yl-1H-imidazol-1-ium-2-yl)nonyl]azetidin-1-ium-3-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 1-methyl-N-[(1S)-7-oxo-1-(5-quinoxalin-2-yl-1H-imidazol-1-ium-2-yl)nonyl]azetidin-1-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87331428 |
| Molecular Formula | C29H34F6N6O6 |
| Molecular Weight | 676.62 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | 1-methyl-N-[(1S)-7-oxo-1-(5-quinoxalin-2-yl-1H-imidazol-1-ium-2-yl)nonyl]azetidin-1-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1C[NH+](C)C1)C1=NC=C(c2cnc3ccccc3n2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H32N6O2.2C2HF3O2/c1-3-18(32)9-5-4-6-12-21(30-25(33)17-15-31(2)16-17)24-27-14-23(29-24)22-13-26-19-10-7-8-11-20(19)28-22;2*3-2(4,5)1(6)7/h7-8,10-11,13-14,17,21H,3-6,9,12,15-16H2,1-2H3,(H,27,29)(H,30,33);2*(H,6,7)/t21-;;/m0../s1 |
| InChIKey | UQCSUXHTVOUVQX-FGJQBABTSA-N |
| XLogP | -0.94 |
| TPSA | 185.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.62 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|