About 1H-pyrazole;bis(2,2,2-trifluoroacetic acid)
1H-pyrazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87332020) has the molecular formula C7H6F6N2O4
and a molecular weight of 296.12 g/mol. Its IUPAC name is 1H-pyrazole;bis(2,2,2-trifluoroacetic acid).
Molecular Properties
| Compound Name | 1H-pyrazole;bis(2,2,2-trifluoroacetic acid) |
| PubChem CID | 87332020 |
| Molecular Formula | C7H6F6N2O4 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1H-pyrazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cn[nH]c1 |
| InChI | InChI=1S/C3H4N2.2C2HF3O2/c1-2-4-5-3-1;2*3-2(4,5)1(6)7/h1-3H,(H,4,5);2*(H,6,7) |
| InChIKey | ZVVHKCKKZDAHHU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazole;bis(2,2,2-trifluoroacetic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;bis(2,2,2-trifluoroacetic acid)?
The IUPAC name of 1H-pyrazole;bis(2,2,2-trifluoroacetic acid) (CID 87332020) is 1H-pyrazole;bis(2,2,2-trifluoroacetic acid).
What is the SMILES notation for 1H-pyrazole;bis(2,2,2-trifluoroacetic acid)?
The canonical SMILES for 1H-pyrazole;bis(2,2,2-trifluoroacetic acid) is O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;bis(2,2,2-trifluoroacetic acid)?
The InChIKey is ZVVHKCKKZDAHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.2C2HF3O2/c1-2-4-5-3-1;2*3-2(4,5)1(6)7/h1-3H,(H,4,5);2*(H,6,7).
What are the key properties of 1H-pyrazole;bis(2,2,2-trifluoroacetic acid)?
1H-pyrazole;bis(2,2,2-trifluoroacetic acid) has a molecular weight of 296.12 g/mol, XLogP of 1.68, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;bis(2,2,2-trifluoroacetic acid) is sourced from PubChem (CID 87332020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).