C26H29F3N4O6S — CID 87332063
N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]-4-sulfamoylbenzamide;2,2,2-trifluoroacetate (PubChem CID 87332063) has the molecular formula C26H29F3N4O6S and a molecular weight of 582.60 g/mol. Its IUPAC name is N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]-4-sulfamoylbenzamide;2,2,2-trifluoroacetate.
| Compound Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]-4-sulfamoylbenzamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87332063 |
| Molecular Formula | C26H29F3N4O6S |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]-4-sulfamoylbenzamide;2,2,2-trifluoroacetate |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)c1ccc(S(N)(=O)=O)cc1)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H28N4O4S.C2HF3O2/c1-17(29)8-4-2-7-11-21(23-26-16-22(27-23)18-9-5-3-6-10-18)28-24(30)19-12-14-20(15-13-19)33(25,31)32;3-2(4,5)1(6)7/h3,5-6,9-10,12-16,21H,2,4,7-8,11H2,1H3,(H,26,27)(H,28,30)(H2,25,31,32);(H,6,7)/t21-;/m0./s1 |
| InChIKey | WTWHJYKFUUAYHP-BOXHHOBZSA-N |
| XLogP | 1.24 |
| TPSA | 175.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|