C19H24F3N3O3S — CID 87332198
(6-benzyl-8-methyl-2-propan-2-yl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-3-yl) trifluoromethanesulfonate (PubChem CID 87332198) has the molecular formula C19H24F3N3O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is (6-benzyl-8-methyl-2-propan-2-yl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-3-yl) trifluoromethanesulfonate.
| Compound Name | (6-benzyl-8-methyl-2-propan-2-yl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87332198 |
| Molecular Formula | C19H24F3N3O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (6-benzyl-8-methyl-2-propan-2-yl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-3-yl) trifluoromethanesulfonate |
| SMILES | CC1CN(Cc2ccccc2)CCc2c1nn(C(C)C)c2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H24F3N3O3S/c1-13(2)25-18(28-29(26,27)19(20,21)22)16-9-10-24(11-14(3)17(16)23-25)12-15-7-5-4-6-8-15/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | DFIWDGBSFGFXNH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|