About 5-sulfanylazepan-2-one
5-sulfanylazepan-2-one (PubChem CID 87332653) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is 5-sulfanylazepan-2-one.
Molecular Properties
| Compound Name | 5-sulfanylazepan-2-one |
| PubChem CID | 87332653 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 5-sulfanylazepan-2-one |
| SMILES | O=C1CCC(S)CCN1 |
| InChI | InChI=1S/C6H11NOS/c8-6-2-1-5(9)3-4-7-6/h5,9H,1-4H2,(H,7,8) |
| InChIKey | IEKORHOSYLJKOP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfanylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfanylazepan-2-one?
The IUPAC name of 5-sulfanylazepan-2-one (CID 87332653) is 5-sulfanylazepan-2-one.
What is the SMILES notation for 5-sulfanylazepan-2-one?
The canonical SMILES for 5-sulfanylazepan-2-one is O=C1CCC(S)CCN1.
What is the InChIKey of 5-sulfanylazepan-2-one?
The InChIKey is IEKORHOSYLJKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c8-6-2-1-5(9)3-4-7-6/h5,9H,1-4H2,(H,7,8).
What are the key properties of 5-sulfanylazepan-2-one?
5-sulfanylazepan-2-one has a molecular weight of 145.23 g/mol, XLogP of 0.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfanylazepan-2-one is sourced from PubChem (CID 87332653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).