About bicyclo[2.2.0]hexane;isocyanic acid
bicyclo[2.2.0]hexane;isocyanic acid (PubChem CID 87332966) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is bicyclo[2.2.0]hexane;isocyanic acid.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexane;isocyanic acid |
| PubChem CID | 87332966 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | bicyclo[2.2.0]hexane;isocyanic acid |
| SMILES | C1CC2CCC12.N=C=O |
| InChI | InChI=1S/C6H10.CHNO/c1-2-6-4-3-5(1)6;2-1-3/h5-6H,1-4H2;2H |
| InChIKey | VYMXCGXAUGZIQW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexane;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexane;isocyanic acid?
The IUPAC name of bicyclo[2.2.0]hexane;isocyanic acid (CID 87332966) is bicyclo[2.2.0]hexane;isocyanic acid.
What is the SMILES notation for bicyclo[2.2.0]hexane;isocyanic acid?
The canonical SMILES for bicyclo[2.2.0]hexane;isocyanic acid is C1CC2CCC12.N=C=O.
What is the InChIKey of bicyclo[2.2.0]hexane;isocyanic acid?
The InChIKey is VYMXCGXAUGZIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10.CHNO/c1-2-6-4-3-5(1)6;2-1-3/h5-6H,1-4H2;2H.
What are the key properties of bicyclo[2.2.0]hexane;isocyanic acid?
bicyclo[2.2.0]hexane;isocyanic acid has a molecular weight of 125.17 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexane;isocyanic acid is sourced from PubChem (CID 87332966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).