C20H28FN5O5S — CID 87333262
tert-butyl 4-[4-[(5S)-5-[(carbamoylamino)-sulfanylmethyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 87333262) has the molecular formula C20H28FN5O5S and a molecular weight of 469.54 g/mol. Its IUPAC name is tert-butyl 4-[4-[(5S)-5-[(carbamoylamino)-sulfanylmethyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(5S)-5-[(carbamoylamino)-sulfanylmethyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87333262 |
| Molecular Formula | C20H28FN5O5S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | tert-butyl 4-[4-[(5S)-5-[(carbamoylamino)-sulfanylmethyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N3C[C@@H](C(S)NC(N)=O)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H28FN5O5S/c1-20(2,3)31-18(28)25-8-6-24(7-9-25)14-5-4-12(10-13(14)21)26-11-15(30-19(26)29)16(32)23-17(22)27/h4-5,10,15-16,32H,6-9,11H2,1-3H3,(H3,22,23,27)/t15-,16?/m0/s1 |
| InChIKey | JMXXPHNKMWHSFN-VYRBHSGPSA-N |
| XLogP | 2.13 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|