C26H26ClF3N6O3 — CID 87333333
N-[(2R,3S,4R)-4-[2-chloro-6-(naphthalen-1-ylmethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide (PubChem CID 87333333) has the molecular formula C26H26ClF3N6O3 and a molecular weight of 562.98 g/mol. Its IUPAC name is N-[(2R,3S,4R)-4-[2-chloro-6-(naphthalen-1-ylmethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide.
| Compound Name | N-[(2R,3S,4R)-4-[2-chloro-6-(naphthalen-1-ylmethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide |
|---|---|
| PubChem CID | 87333333 |
| Molecular Formula | C26H26ClF3N6O3 |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | N-[(2R,3S,4R)-4-[2-chloro-6-(naphthalen-1-ylmethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide |
| SMILES | CCCN(C(=O)C(F)(F)F)C1C[C@@H](n2cnc3c(NCc4cccc5ccccc45)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H26ClF3N6O3/c1-2-10-35(24(39)26(28,29)30)17-11-18(21(38)20(17)37)36-13-32-19-22(33-25(27)34-23(19)36)31-12-15-8-5-7-14-6-3-4-9-16(14)15/h3-9,13,17-18,20-21,37-38H,2,10-12H2,1H3,(H,31,33,34)/t17?,18-,20-,21+/m1/s1 |
| InChIKey | GCZPCHFNNXBFHF-SMOPAVHSSA-N |
| XLogP | 4.08 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |