About {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile
{4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile (PubChem CID 873338) has the molecular formula C17H13N3OS
and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[[4-methoxy-2-(pyridin-2-ylsulfanylmethyl)phenyl]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile |
| PubChem CID | 873338 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[[4-methoxy-2-(pyridin-2-ylsulfanylmethyl)phenyl]methylidene]propanedinitrile |
| SMILES | COC1=CC(=C(C=C1)C=C(C#N)C#N)CSC2=CC=CC=N2 |
| InChI | InChI=1S/C17H13N3OS/c1-21-16-6-5-14(8-13(10-18)11-19)15(9-16)12-22-17-4-2-3-7-20-17/h2-9H,12H2,1H3 |
| InChIKey | KNXILUICPKDVBI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | 469 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile?
The IUPAC name of {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile (CID 873338) is 2-[[4-methoxy-2-(pyridin-2-ylsulfanylmethyl)phenyl]methylidene]propanedinitrile.
What is the SMILES notation for {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile?
The canonical SMILES for {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile is COC1=CC(=C(C=C1)C=C(C#N)C#N)CSC2=CC=CC=N2.
What is the InChIKey of {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile?
The InChIKey is KNXILUICPKDVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3OS/c1-21-16-6-5-14(8-13(10-18)11-19)15(9-16)12-22-17-4-2-3-7-20-17/h2-9H,12H2,1H3.
What are the key properties of {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile?
{4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile has a molecular weight of 307.40 g/mol, XLogP of 3.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for {4-Methoxy-2-[(2-pyridinylthio)methyl]benzylidene}malononitrile is sourced from PubChem (CID 873338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).