C9H15Cl5O — CID 87333897
8,8,9,9,9-pentachlorononan-1-ol (PubChem CID 87333897) has the molecular formula C9H15Cl5O and a molecular weight of 316.48 g/mol. Its IUPAC name is 8,8,9,9,9-pentachlorononan-1-ol.
| Compound Name | 8,8,9,9,9-pentachlorononan-1-ol |
|---|---|
| PubChem CID | 87333897 |
| Molecular Formula | C9H15Cl5O |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 8,8,9,9,9-pentachlorononan-1-ol |
| SMILES | OCCCCCCCC(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H15Cl5O/c10-8(11,9(12,13)14)6-4-2-1-3-5-7-15/h15H,1-7H2 |
| InChIKey | XVRFEWKHPKQNGD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|