C33H33F3N10O3 — CID 87333970
N-[3-[2-amino-6-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]purin-9-yl]propyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide (PubChem CID 87333970) has the molecular formula C33H33F3N10O3 and a molecular weight of 674.69 g/mol. Its IUPAC name is N-[3-[2-amino-6-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]purin-9-yl]propyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide.
| Compound Name | N-[3-[2-amino-6-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]purin-9-yl]propyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide |
|---|---|
| PubChem CID | 87333970 |
| Molecular Formula | C33H33F3N10O3 |
| Molecular Weight | 674.69 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | N-[3-[2-amino-6-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]purin-9-yl]propyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(C(=O)NCCCn3cnc4c(OCc5ccc(CNC(=O)C(F)(F)F)cc5)nc(N)nc43)cc2)cc1 |
| InChI | InChI=1S/C33H33F3N10O3/c1-45(2)26-14-12-25(13-15-26)44-43-24-10-8-23(9-11-24)29(47)38-16-3-17-46-20-40-27-28(46)41-32(37)42-30(27)49-19-22-6-4-21(5-7-22)18-39-31(48)33(34,35)36/h4-15,20H,3,16-19H2,1-2H3,(H,38,47)(H,39,48)(H2,37,41,42)/b44-43+ |
| InChIKey | AYIGEOYXYJAJOO-VGFSZAGXSA-N |
| XLogP | 5.47 |
| TPSA | 165.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|