C21H19F5N2OS — CID 87334057
4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-5-ol (PubChem CID 87334057) has the molecular formula C21H19F5N2OS and a molecular weight of 442.45 g/mol. Its IUPAC name is 4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-5-ol.
| Compound Name | 4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-5-ol |
|---|---|
| PubChem CID | 87334057 |
| Molecular Formula | C21H19F5N2OS |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-[4-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-5-ol |
| SMILES | Oc1ccc2scnc2c1N1CCC(Cc2cccc(C(F)(F)C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H19F5N2OS/c22-20(23,21(24,25)26)15-3-1-2-14(11-15)10-13-6-8-28(9-7-13)19-16(29)4-5-17-18(19)27-12-30-17/h1-5,11-13,29H,6-10H2 |
| InChIKey | BDHPEZKJXPSQPX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|