C8H12O5 — CID 87334370
(2S,3R,4R)-2,3,4-trihydroxy-5-prop-1-ynoxypentanal (PubChem CID 87334370) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4-trihydroxy-5-prop-1-ynoxypentanal.
| Compound Name | (2S,3R,4R)-2,3,4-trihydroxy-5-prop-1-ynoxypentanal |
|---|---|
| PubChem CID | 87334370 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (2S,3R,4R)-2,3,4-trihydroxy-5-prop-1-ynoxypentanal |
| SMILES | CC#COC[C@@H](O)[C@@H](O)[C@H](O)C=O |
| InChI | InChI=1S/C8H12O5/c1-2-3-13-5-7(11)8(12)6(10)4-9/h4,6-8,10-12H,5H2,1H3/t6-,7-,8+/m1/s1 |
| InChIKey | JLJTVJWQTVFNHL-PRJMDXOYSA-N |
| XLogP | -1.73 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|