About CID 87335727
CID 87335727 (PubChem CID 87335727) has the molecular formula C6H15N2Si
and a molecular weight of 143.29 g/mol.
Molecular Properties
| Compound Name | CID 87335727 |
| PubChem CID | 87335727 |
| Molecular Formula | C6H15N2Si |
| Molecular Weight | 143.29 g/mol |
| Exact Mass | 143.10 |
| IUPAC Name | — |
| SMILES | CCNC(C[Si])NCC |
| InChI | InChI=1S/C6H15N2Si/c1-3-7-6(5-9)8-4-2/h6-8H,3-5H2,1-2H3 |
| InChIKey | ISVBISXZZVEGEG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 87335727 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87335727?
The IUPAC name of CID 87335727 (CID 87335727) is not available.
What is the SMILES notation for CID 87335727?
The canonical SMILES for CID 87335727 is CCNC(C[Si])NCC.
What is the InChIKey of CID 87335727?
The InChIKey is ISVBISXZZVEGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N2Si/c1-3-7-6(5-9)8-4-2/h6-8H,3-5H2,1-2H3.
What are the key properties of CID 87335727?
CID 87335727 has a molecular weight of 143.29 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87335727 is sourced from PubChem (CID 87335727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).