C15H12ClFN4O2 — CID 87335835
7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylisoquinoline-1,3-dione (PubChem CID 87335835) has the molecular formula C15H12ClFN4O2 and a molecular weight of 334.74 g/mol. Its IUPAC name is 7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylisoquinoline-1,3-dione.
| Compound Name | 7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 87335835 |
| Molecular Formula | C15H12ClFN4O2 |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylisoquinoline-1,3-dione |
| SMILES | CC1(C)C(=O)NC(=O)c2cc(Nc3nc(Cl)ncc3F)ccc21 |
| InChI | InChI=1S/C15H12ClFN4O2/c1-15(2)9-4-3-7(5-8(9)12(22)21-13(15)23)19-11-10(17)6-18-14(16)20-11/h3-6H,1-2H3,(H,18,19,20)(H,21,22,23) |
| InChIKey | HSVUPMAIJRWSHU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|