About oxepane-2,7-dithione
oxepane-2,7-dithione (PubChem CID 87336392) has the molecular formula C6H8OS2
and a molecular weight of 160.26 g/mol. Its IUPAC name is oxepane-2,7-dithione.
Molecular Properties
| Compound Name | oxepane-2,7-dithione |
| PubChem CID | 87336392 |
| Molecular Formula | C6H8OS2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | oxepane-2,7-dithione |
| SMILES | S=C1CCCCC(=S)O1 |
| InChI | InChI=1S/C6H8OS2/c8-5-3-1-2-4-6(9)7-5/h1-4H2 |
| InChIKey | FXIHUAHTTAWXTL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze oxepane-2,7-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxepane-2,7-dithione?
The IUPAC name of oxepane-2,7-dithione (CID 87336392) is oxepane-2,7-dithione.
What is the SMILES notation for oxepane-2,7-dithione?
The canonical SMILES for oxepane-2,7-dithione is S=C1CCCCC(=S)O1.
What is the InChIKey of oxepane-2,7-dithione?
The InChIKey is FXIHUAHTTAWXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS2/c8-5-3-1-2-4-6(9)7-5/h1-4H2.
What are the key properties of oxepane-2,7-dithione?
oxepane-2,7-dithione has a molecular weight of 160.26 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxepane-2,7-dithione is sourced from PubChem (CID 87336392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).