C16H27N — CID 87336510
1-pentyl-2,2,3-tris(prop-2-enyl)aziridine (PubChem CID 87336510) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 1-pentyl-2,2,3-tris(prop-2-enyl)aziridine.
| Compound Name | 1-pentyl-2,2,3-tris(prop-2-enyl)aziridine |
|---|---|
| PubChem CID | 87336510 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-pentyl-2,2,3-tris(prop-2-enyl)aziridine |
| SMILES | C=CCC1N(CCCCC)C1(CC=C)CC=C |
| InChI | InChI=1S/C16H27N/c1-5-9-10-14-17-15(11-6-2)16(17,12-7-3)13-8-4/h6-8,15H,2-5,9-14H2,1H3 |
| InChIKey | SLTQQSKOSSQICG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|