C19H18F6N2O5S — CID 87336615
8-(4-methylsulfanylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87336615) has the molecular formula C19H18F6N2O5S and a molecular weight of 500.42 g/mol. Its IUPAC name is 8-(4-methylsulfanylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 8-(4-methylsulfanylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87336615 |
| Molecular Formula | C19H18F6N2O5S |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 8-(4-methylsulfanylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CSc1ccc(-c2ccc3c(n2)OCCNC3)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H16N2OS.2C2HF3O2/c1-19-13-5-2-11(3-6-13)14-7-4-12-10-16-8-9-18-15(12)17-14;2*3-2(4,5)1(6)7/h2-7,16H,8-10H2,1H3;2*(H,6,7) |
| InChIKey | JGKCVBUIILNLOZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |