C9H12Cl2N2O — CID 87336665
8-chloro-3-methyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;hydrochloride (PubChem CID 87336665) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 8-chloro-3-methyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;hydrochloride.
| Compound Name | 8-chloro-3-methyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;hydrochloride |
|---|---|
| PubChem CID | 87336665 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 8-chloro-3-methyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;hydrochloride |
| SMILES | CC1COc2nc(Cl)ccc2CN1.Cl |
| InChI | InChI=1S/C9H11ClN2O.ClH/c1-6-5-13-9-7(4-11-6)2-3-8(10)12-9;/h2-3,6,11H,4-5H2,1H3;1H |
| InChIKey | PUUCRIMPTCPFFH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|