C20H20F6N2O5 — CID 87337020
8-(2,4-dimethylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87337020) has the molecular formula C20H20F6N2O5 and a molecular weight of 482.38 g/mol. Its IUPAC name is 8-(2,4-dimethylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 8-(2,4-dimethylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87337020 |
| Molecular Formula | C20H20F6N2O5 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 8-(2,4-dimethylphenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(-c2ccc3c(n2)OCCNC3)c(C)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H18N2O.2C2HF3O2/c1-11-3-5-14(12(2)9-11)15-6-4-13-10-17-7-8-19-16(13)18-15;2*3-2(4,5)1(6)7/h3-6,9,17H,7-8,10H2,1-2H3;2*(H,6,7) |
| InChIKey | CSDVIVJAIZSYKB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |