About 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine
7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine (PubChem CID 87337380) has the molecular formula C10H5Cl3N6
and a molecular weight of 315.55 g/mol. Its IUPAC name is 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine.
Molecular Properties
| Compound Name | 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine |
| PubChem CID | 87337380 |
| Molecular Formula | C10H5Cl3N6 |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine |
| SMILES | Clc1nc(Cn2cnc3ncncc32)nc(Cl)c1Cl |
| InChI | InChI=1S/C10H5Cl3N6/c11-7-8(12)17-6(18-9(7)13)2-19-4-16-10-5(19)1-14-3-15-10/h1,3-4H,2H2 |
| InChIKey | RINUFKNZBMAVID-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine?
The IUPAC name of 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine (CID 87337380) is 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine.
What is the SMILES notation for 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine?
The canonical SMILES for 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine is Clc1nc(Cn2cnc3ncncc32)nc(Cl)c1Cl.
What is the InChIKey of 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine?
The InChIKey is RINUFKNZBMAVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl3N6/c11-7-8(12)17-6(18-9(7)13)2-19-4-16-10-5(19)1-14-3-15-10/h1,3-4H,2H2.
What are the key properties of 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine?
7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine has a molecular weight of 315.55 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4,5,6-trichloropyrimidin-2-yl)methyl]purine is sourced from PubChem (CID 87337380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).