C13H13N3O4 — CID 87337782
2-(3-amino-3-oxopropyl)-N-hydroxy-1-oxoisoquinoline-7-carboxamide (PubChem CID 87337782) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-(3-amino-3-oxopropyl)-N-hydroxy-1-oxoisoquinoline-7-carboxamide.
| Compound Name | 2-(3-amino-3-oxopropyl)-N-hydroxy-1-oxoisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 87337782 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(3-amino-3-oxopropyl)-N-hydroxy-1-oxoisoquinoline-7-carboxamide |
| SMILES | NC(=O)CCn1ccc2ccc(C(=O)NO)cc2c1=O |
| InChI | InChI=1S/C13H13N3O4/c14-11(17)4-6-16-5-3-8-1-2-9(12(18)15-20)7-10(8)13(16)19/h1-3,5,7,20H,4,6H2,(H2,14,17)(H,15,18) |
| InChIKey | UPGQRTUZZWIHBN-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|