About 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline
4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline (PubChem CID 87337871) has the molecular formula C13H21FNO2P
and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline.
Molecular Properties
| Compound Name | 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline |
| PubChem CID | 87337871 |
| Molecular Formula | C13H21FNO2P |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline |
| SMILES | CC(OP(=O)(F)Cc1ccc(N)cc1)C(C)(C)C |
| InChI | InChI=1S/C13H21FNO2P/c1-10(13(2,3)4)17-18(14,16)9-11-5-7-12(15)8-6-11/h5-8,10H,9,15H2,1-4H3 |
| InChIKey | JTGFWHWEKDNVKT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline?
The IUPAC name of 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline (CID 87337871) is 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline.
What is the SMILES notation for 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline?
The canonical SMILES for 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline is CC(OP(=O)(F)Cc1ccc(N)cc1)C(C)(C)C.
What is the InChIKey of 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline?
The InChIKey is JTGFWHWEKDNVKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21FNO2P/c1-10(13(2,3)4)17-18(14,16)9-11-5-7-12(15)8-6-11/h5-8,10H,9,15H2,1-4H3.
What are the key properties of 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline?
4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline has a molecular weight of 273.29 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,3-dimethylbutan-2-yloxy(fluoro)phosphoryl]methyl]aniline is sourced from PubChem (CID 87337871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).