About carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine
carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine (PubChem CID 87337876) has the molecular formula C16H24F2N2O5
and a molecular weight of 362.37 g/mol. Its IUPAC name is carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine |
| PubChem CID | 87337876 |
| Molecular Formula | C16H24F2N2O5 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine |
| SMILES | CC(C)(C)Nc1nccc(C(F)F)c1C(C)(C)C.O=C(O)OC(=O)O |
| InChI | InChI=1S/C14H22F2N2.C2H2O5/c1-13(2,3)10-9(11(15)16)7-8-17-12(10)18-14(4,5)6;3-1(4)7-2(5)6/h7-8,11H,1-6H3,(H,17,18);(H,3,4)(H,5,6) |
| InChIKey | KDCAFXGKQPRIDI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine?
The IUPAC name of carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine (CID 87337876) is carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine.
What is the SMILES notation for carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine?
The canonical SMILES for carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine is CC(C)(C)Nc1nccc(C(F)F)c1C(C)(C)C.O=C(O)OC(=O)O.
What is the InChIKey of carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine?
The InChIKey is KDCAFXGKQPRIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2.C2H2O5/c1-13(2,3)10-9(11(15)16)7-8-17-12(10)18-14(4,5)6;3-1(4)7-2(5)6/h7-8,11H,1-6H3,(H,17,18);(H,3,4)(H,5,6).
What are the key properties of carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine?
carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine has a molecular weight of 362.37 g/mol, XLogP of 4.89, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carboxy hydrogen carbonate;N,3-ditert-butyl-4-(difluoromethyl)pyridin-2-amine is sourced from PubChem (CID 87337876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).