About 2-methoxy-N,N-dipropylpropanamide
2-methoxy-N,N-dipropylpropanamide (PubChem CID 87337988) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-methoxy-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | 2-methoxy-N,N-dipropylpropanamide |
| PubChem CID | 87337988 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-methoxy-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(C)OC |
| InChI | InChI=1S/C10H21NO2/c1-5-7-11(8-6-2)10(12)9(3)13-4/h9H,5-8H2,1-4H3 |
| InChIKey | VSPSHEGRKLOXLB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,N-dipropylpropanamide?
The IUPAC name of 2-methoxy-N,N-dipropylpropanamide (CID 87337988) is 2-methoxy-N,N-dipropylpropanamide.
What is the SMILES notation for 2-methoxy-N,N-dipropylpropanamide?
The canonical SMILES for 2-methoxy-N,N-dipropylpropanamide is CCCN(CCC)C(=O)C(C)OC.
What is the InChIKey of 2-methoxy-N,N-dipropylpropanamide?
The InChIKey is VSPSHEGRKLOXLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-5-7-11(8-6-2)10(12)9(3)13-4/h9H,5-8H2,1-4H3.
What are the key properties of 2-methoxy-N,N-dipropylpropanamide?
2-methoxy-N,N-dipropylpropanamide has a molecular weight of 187.28 g/mol, XLogP of 1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,N-dipropylpropanamide is sourced from PubChem (CID 87337988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).