C8H4F14O — CID 87337995
1,1,2,2,4,4,4-heptafluoro-1-(1,1,2,2,4,4,4-heptafluorobutoxy)butane (PubChem CID 87337995) has the molecular formula C8H4F14O and a molecular weight of 382.09 g/mol. Its IUPAC name is 1,1,2,2,4,4,4-heptafluoro-1-(1,1,2,2,4,4,4-heptafluorobutoxy)butane.
| Compound Name | 1,1,2,2,4,4,4-heptafluoro-1-(1,1,2,2,4,4,4-heptafluorobutoxy)butane |
|---|---|
| PubChem CID | 87337995 |
| Molecular Formula | C8H4F14O |
| Molecular Weight | 382.09 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 1,1,2,2,4,4,4-heptafluoro-1-(1,1,2,2,4,4,4-heptafluorobutoxy)butane |
| SMILES | FC(F)(F)CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C8H4F14O/c9-3(10,1-5(13,14)15)7(19,20)23-8(21,22)4(11,12)2-6(16,17)18/h1-2H2 |
| InChIKey | OOWAARMDMOWGDJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.09 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|