About 2-propoxy-N,N-dipropylpropanamide
2-propoxy-N,N-dipropylpropanamide (PubChem CID 87338040) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-propoxy-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | 2-propoxy-N,N-dipropylpropanamide |
| PubChem CID | 87338040 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-propoxy-N,N-dipropylpropanamide |
| SMILES | CCCOC(C)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C12H25NO2/c1-5-8-13(9-6-2)12(14)11(4)15-10-7-3/h11H,5-10H2,1-4H3 |
| InChIKey | DLCAKXFOZGKBTP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propoxy-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-N,N-dipropylpropanamide?
The IUPAC name of 2-propoxy-N,N-dipropylpropanamide (CID 87338040) is 2-propoxy-N,N-dipropylpropanamide.
What is the SMILES notation for 2-propoxy-N,N-dipropylpropanamide?
The canonical SMILES for 2-propoxy-N,N-dipropylpropanamide is CCCOC(C)C(=O)N(CCC)CCC.
What is the InChIKey of 2-propoxy-N,N-dipropylpropanamide?
The InChIKey is DLCAKXFOZGKBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-5-8-13(9-6-2)12(14)11(4)15-10-7-3/h11H,5-10H2,1-4H3.
What are the key properties of 2-propoxy-N,N-dipropylpropanamide?
2-propoxy-N,N-dipropylpropanamide has a molecular weight of 215.34 g/mol, XLogP of 2.45, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-N,N-dipropylpropanamide is sourced from PubChem (CID 87338040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).