About ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate
ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate (PubChem CID 87338429) has the molecular formula C21H23N3O5S
and a molecular weight of 429.50 g/mol. Its IUPAC name is ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate |
| PubChem CID | 87338429 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(/C(N)=N/O)c2c1ccn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23N3O5S/c1-3-29-19(25)11-7-15-6-10-18(21(22)23-26)20-17(15)12-13-24(20)30(27,28)16-8-4-14(2)5-9-16/h4-6,8-10,12-13,26H,3,7,11H2,1-2H3,(H2,22,23) |
| InChIKey | SYYSYNDLBBLUHC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate?
The IUPAC name of ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate (CID 87338429) is ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate.
What is the SMILES notation for ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate?
The canonical SMILES for ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate is CCOC(=O)CCc1ccc(/C(N)=N/O)c2c1ccn2S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate?
The InChIKey is SYYSYNDLBBLUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O5S/c1-3-29-19(25)11-7-15-6-10-18(21(22)23-26)20-17(15)12-13-24(20)30(27,28)16-8-4-14(2)5-9-16/h4-6,8-10,12-13,26H,3,7,11H2,1-2H3,(H2,22,23).
What are the key properties of ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate?
ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate has a molecular weight of 429.50 g/mol, XLogP of 2.78, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[7-[(Z)-N'-hydroxycarbamimidoyl]-1-(4-methylphenyl)sulfonylindol-4-yl]propanoate is sourced from PubChem (CID 87338429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).