About (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate
(diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate (PubChem CID 87338647) has the molecular formula C5H10F5NO4S2
and a molecular weight of 307.26 g/mol. Its IUPAC name is (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate |
| PubChem CID | 87338647 |
| Molecular Formula | C5H10F5NO4S2 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate |
| SMILES | CCN(CC)S(=O)(F)(F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H10F5NO4S2/c1-3-11(4-2)17(9,10,14)15-16(12,13)5(6,7)8/h3-4H2,1-2H3 |
| InChIKey | GWPOOQMMNWSBDK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate?
The IUPAC name of (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate (CID 87338647) is (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate.
What is the SMILES notation for (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate?
The canonical SMILES for (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate is CCN(CC)S(=O)(F)(F)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate?
The InChIKey is GWPOOQMMNWSBDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F5NO4S2/c1-3-11(4-2)17(9,10,14)15-16(12,13)5(6,7)8/h3-4H2,1-2H3.
What are the key properties of (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate?
(diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate has a molecular weight of 307.26 g/mol, XLogP of 1.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (diethylamino-difluoro-oxo-λ6-sulfanyl) trifluoromethanesulfonate is sourced from PubChem (CID 87338647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).