C14H30N4 — CID 87338661
1-N',2-N'-ditert-butyl-1-N,1-N,2-N,2-N-tetramethylethanediimidamide (PubChem CID 87338661) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-N',2-N'-ditert-butyl-1-N,1-N,2-N,2-N-tetramethylethanediimidamide.
| Compound Name | 1-N',2-N'-ditert-butyl-1-N,1-N,2-N,2-N-tetramethylethanediimidamide |
|---|---|
| PubChem CID | 87338661 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 1-N',2-N'-ditert-butyl-1-N,1-N,2-N,2-N-tetramethylethanediimidamide |
| SMILES | CN(C)C(=N\C(C)(C)C)/C(=N/C(C)(C)C)N(C)C |
| InChI | InChI=1S/C14H30N4/c1-13(2,3)15-11(17(7)8)12(18(9)10)16-14(4,5)6/h1-10H3/b15-11-,16-12- |
| InChIKey | DOPNLCQWWPBMIM-NFLUSIDLSA-N |
| XLogP | 2.50 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|