C26H22F8O6S2 — CID 87339595
[1,1,1,3,3-pentafluoro-3-[1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-yl]oxysulfonylpropan-2-yl] benzoate (PubChem CID 87339595) has the molecular formula C26H22F8O6S2 and a molecular weight of 646.57 g/mol. Its IUPAC name is [1,1,1,3,3-pentafluoro-3-[1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-yl]oxysulfonylpropan-2-yl] benzoate.
| Compound Name | [1,1,1,3,3-pentafluoro-3-[1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-yl]oxysulfonylpropan-2-yl] benzoate |
|---|---|
| PubChem CID | 87339595 |
| Molecular Formula | C26H22F8O6S2 |
| Molecular Weight | 646.57 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | [1,1,1,3,3-pentafluoro-3-[1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-yl]oxysulfonylpropan-2-yl] benzoate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)OS1(c2cccc3ccccc23)CCC(OCC(F)(F)F)C1)c1ccccc1 |
| InChI | InChI=1S/C26H22F8O6S2/c27-24(28,29)16-38-19-13-14-41(15-19,21-12-6-10-17-7-4-5-11-20(17)21)40-42(36,37)26(33,34)23(25(30,31)32)39-22(35)18-8-2-1-3-9-18/h1-12,19,23H,13-16H2 |
| InChIKey | UQMALXGBNDADGE-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |