C26H22F8O6S2 — CID 87339596
2-benzoyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-ium (PubChem CID 87339596) has the molecular formula C26H22F8O6S2 and a molecular weight of 646.57 g/mol. Its IUPAC name is 2-benzoyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-ium.
| Compound Name | 2-benzoyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-ium |
|---|---|
| PubChem CID | 87339596 |
| Molecular Formula | C26H22F8O6S2 |
| Molecular Weight | 646.57 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | 2-benzoyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-naphthalen-1-yl-3-(2,2,2-trifluoroethoxy)thiolan-1-ium |
| SMILES | FC(F)(F)COC1CC[S+](c2cccc3ccccc23)C1.O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H16F3OS.C10H7F5O5S/c17-16(18,19)11-20-13-8-9-21(10-13)15-7-3-5-12-4-1-2-6-14(12)15;11-9(12,13)8(10(14,15)21(17,18)19)20-7(16)6-4-2-1-3-5-6/h1-7,13H,8-11H2;1-5,8H,(H,17,18,19)/q+1;/p-1 |
| InChIKey | HNEOEZWUCULYCL-UHFFFAOYSA-M |
| XLogP | 6.08 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|