C16H28F4O2S — CID 87339643
2-methylpropyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)heptanoate (PubChem CID 87339643) has the molecular formula C16H28F4O2S and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-methylpropyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)heptanoate.
| Compound Name | 2-methylpropyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)heptanoate |
|---|---|
| PubChem CID | 87339643 |
| Molecular Formula | C16H28F4O2S |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-methylpropyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)heptanoate |
| SMILES | CCCCCC(SCCCC(F)(F)C(F)F)C(=O)OCC(C)C |
| InChI | InChI=1S/C16H28F4O2S/c1-4-5-6-8-13(14(21)22-11-12(2)3)23-10-7-9-16(19,20)15(17)18/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | IWOBZLCONLULDO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|