C13H21F5O2S — CID 87339691
4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoic acid (PubChem CID 87339691) has the molecular formula C13H21F5O2S and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoic acid.
| Compound Name | 4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 87339691 |
| Molecular Formula | C13H21F5O2S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoic acid |
| SMILES | CC(C)CC(SCCCCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H21F5O2S/c1-9(2)8-10(11(19)20)21-7-5-3-4-6-12(14,15)13(16,17)18/h9-10H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | CBHZABBZMHRHIZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|