C15H23F7O2S — CID 87339781
2-methylpropyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate (PubChem CID 87339781) has the molecular formula C15H23F7O2S and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-methylpropyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate.
| Compound Name | 2-methylpropyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 87339781 |
| Molecular Formula | C15H23F7O2S |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-methylpropyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate |
| SMILES | CC(C)COC(=O)C(SCCCC(F)(F)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H23F7O2S/c1-9(2)8-24-12(23)11(10(3)4)25-7-5-6-13(16,17)14(18,19)15(20,21)22/h9-11H,5-8H2,1-4H3 |
| InChIKey | BBLJLBBJUWLEGS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|