About butyl 2-(4,4-difluoropentylsulfanyl)pentanoate
butyl 2-(4,4-difluoropentylsulfanyl)pentanoate (PubChem CID 87339798) has the molecular formula C14H26F2O2S
and a molecular weight of 296.42 g/mol. Its IUPAC name is butyl 2-(4,4-difluoropentylsulfanyl)pentanoate.
Molecular Properties
| Compound Name | butyl 2-(4,4-difluoropentylsulfanyl)pentanoate |
| PubChem CID | 87339798 |
| Molecular Formula | C14H26F2O2S |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | butyl 2-(4,4-difluoropentylsulfanyl)pentanoate |
| SMILES | CCCCOC(=O)C(CCC)SCCCC(C)(F)F |
| InChI | InChI=1S/C14H26F2O2S/c1-4-6-10-18-13(17)12(8-5-2)19-11-7-9-14(3,15)16/h12H,4-11H2,1-3H3 |
| InChIKey | YUEVMYSWJRIHMH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-(4,4-difluoropentylsulfanyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-(4,4-difluoropentylsulfanyl)pentanoate?
The IUPAC name of butyl 2-(4,4-difluoropentylsulfanyl)pentanoate (CID 87339798) is butyl 2-(4,4-difluoropentylsulfanyl)pentanoate.
What is the SMILES notation for butyl 2-(4,4-difluoropentylsulfanyl)pentanoate?
The canonical SMILES for butyl 2-(4,4-difluoropentylsulfanyl)pentanoate is CCCCOC(=O)C(CCC)SCCCC(C)(F)F.
What is the InChIKey of butyl 2-(4,4-difluoropentylsulfanyl)pentanoate?
The InChIKey is YUEVMYSWJRIHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2O2S/c1-4-6-10-18-13(17)12(8-5-2)19-11-7-9-14(3,15)16/h12H,4-11H2,1-3H3.
What are the key properties of butyl 2-(4,4-difluoropentylsulfanyl)pentanoate?
butyl 2-(4,4-difluoropentylsulfanyl)pentanoate has a molecular weight of 296.42 g/mol, XLogP of 4.67, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-(4,4-difluoropentylsulfanyl)pentanoate is sourced from PubChem (CID 87339798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).