C13H19F7O2S — CID 87339849
2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoic acid (PubChem CID 87339849) has the molecular formula C13H19F7O2S and a molecular weight of 372.35 g/mol. Its IUPAC name is 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoic acid.
| Compound Name | 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 87339849 |
| Molecular Formula | C13H19F7O2S |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-(5,5,6,6,7,7,7-heptafluoroheptylsulfanyl)-4-methylpentanoic acid |
| SMILES | CC(C)CC(SCCCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H19F7O2S/c1-8(2)7-9(10(21)22)23-6-4-3-5-11(14,15)12(16,17)13(18,19)20/h8-9H,3-7H2,1-2H3,(H,21,22) |
| InChIKey | UAIDLBSIARLTBL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|