C23H23NO4S — CID 8733985
[(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate (PubChem CID 8733985) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is [(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate.
| Compound Name | [(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 8733985 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [(2S)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-[[(2S)-oxolan-2-yl]methylsulfanyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1SC[C@@H]1CCCO1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H23NO4S/c1-15(22(25)19-13-24-20-10-4-2-8-17(19)20)28-23(26)18-9-3-5-11-21(18)29-14-16-7-6-12-27-16/h2-5,8-11,13,15-16,24H,6-7,12,14H2,1H3/t15-,16-/m0/s1 |
| InChIKey | KOGWDNZPVBDQDC-HOTGVXAUSA-N |
| XLogP | 4.87 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |