About methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate
methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate (PubChem CID 87339878) has the molecular formula C12H21F3O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate.
Molecular Properties
| Compound Name | methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate |
| PubChem CID | 87339878 |
| Molecular Formula | C12H21F3O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate |
| SMILES | COC(=O)C(SCCCCCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H21F3O2S/c1-9(2)10(11(16)17-3)18-8-6-4-5-7-12(13,14)15/h9-10H,4-8H2,1-3H3 |
| InChIKey | FPXKJOBJTKTHDJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate?
The IUPAC name of methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate (CID 87339878) is methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate.
What is the SMILES notation for methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate?
The canonical SMILES for methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate is COC(=O)C(SCCCCCC(F)(F)F)C(C)C.
What is the InChIKey of methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate?
The InChIKey is FPXKJOBJTKTHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3O2S/c1-9(2)10(11(16)17-3)18-8-6-4-5-7-12(13,14)15/h9-10H,4-8H2,1-3H3.
What are the key properties of methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate?
methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate has a molecular weight of 286.36 g/mol, XLogP of 4.04, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-2-(6,6,6-trifluorohexylsulfanyl)butanoate is sourced from PubChem (CID 87339878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).