C11H17F5O2S — CID 87339917
2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoic acid (PubChem CID 87339917) has the molecular formula C11H17F5O2S and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoic acid.
| Compound Name | 2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 87339917 |
| Molecular Formula | C11H17F5O2S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoic acid |
| SMILES | CCCC(SCCCC(F)(F)C(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C11H17F5O2S/c1-2-4-7(10(17)18)19-6-3-5-11(15,16)8(12)9(13)14/h7-9H,2-6H2,1H3,(H,17,18) |
| InChIKey | WZALNTNKKABWDR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|