C13H21F5O2S — CID 87339969
methyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate (PubChem CID 87339969) has the molecular formula C13H21F5O2S and a molecular weight of 336.37 g/mol. Its IUPAC name is methyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate.
| Compound Name | methyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87339969 |
| Molecular Formula | C13H21F5O2S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | methyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate |
| SMILES | COC(=O)C(CC(C)C)SCCCC(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C13H21F5O2S/c1-8(2)7-9(12(19)20-3)21-6-4-5-13(17,18)10(14)11(15)16/h8-11H,4-7H2,1-3H3 |
| InChIKey | ZLTHXETVGMCHJY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|