About propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate
propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate (PubChem CID 87339987) has the molecular formula C17H32F2O2S
and a molecular weight of 338.50 g/mol. Its IUPAC name is propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate |
| PubChem CID | 87339987 |
| Molecular Formula | C17H32F2O2S |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate |
| SMILES | CCCCCC(SCCCCC(F)(F)CC)C(=O)OC(C)C |
| InChI | InChI=1S/C17H32F2O2S/c1-5-7-8-11-15(16(20)21-14(3)4)22-13-10-9-12-17(18,19)6-2/h14-15H,5-13H2,1-4H3 |
| InChIKey | SBZGZMDACNTGAU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate?
The IUPAC name of propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate (CID 87339987) is propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate.
What is the SMILES notation for propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate?
The canonical SMILES for propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate is CCCCCC(SCCCCC(F)(F)CC)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate?
The InChIKey is SBZGZMDACNTGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32F2O2S/c1-5-7-8-11-15(16(20)21-14(3)4)22-13-10-9-12-17(18,19)6-2/h14-15H,5-13H2,1-4H3.
What are the key properties of propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate?
propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate has a molecular weight of 338.50 g/mol, XLogP of 5.84, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(5,5-difluoroheptylsulfanyl)heptanoate is sourced from PubChem (CID 87339987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).