methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate

C9H15F3O2S — CID 87339990

IUPACmethyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate
SMILESCOC(=O)C(SCCC(F)(F)F)C(C)C
InChIInChI=1S/C9H15F3O2S/c1-6(2)7(8(13)14-3)15-5-4-9(10,11)12/h6-7H,4-5H2,1-3H3
InChIKeyYYSXYGYNPORXAK-UHFFFAOYSA-N
MW244.28 g/mol
LogP2.87
Rot. Bonds5

About methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate

methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate (PubChem CID 87339990) has the molecular formula C9H15F3O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate.

Molecular Properties

Compound Namemethyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate
PubChem CID87339990
Molecular FormulaC9H15F3O2S
Molecular Weight244.28 g/mol
Exact Mass244.07
IUPAC Namemethyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate
SMILESCOC(=O)C(SCCC(F)(F)F)C(C)C
InChIInChI=1S/C9H15F3O2S/c1-6(2)7(8(13)14-3)15-5-4-9(10,11)12/h6-7H,4-5H2,1-3H3
InChIKeyYYSXYGYNPORXAK-UHFFFAOYSA-N
XLogP2.87
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.28
LogP ≤ 52.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate?
The IUPAC name of methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate (CID 87339990) is methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate.
What is the SMILES notation for methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate?
The canonical SMILES for methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate is COC(=O)C(SCCC(F)(F)F)C(C)C.
What is the InChIKey of methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate?
The InChIKey is YYSXYGYNPORXAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O2S/c1-6(2)7(8(13)14-3)15-5-4-9(10,11)12/h6-7H,4-5H2,1-3H3.
What are the key properties of methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate?
methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate has a molecular weight of 244.28 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-2-(3,3,3-trifluoropropylsulfanyl)butanoate is sourced from PubChem (CID 87339990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).