C12H15F9O2S — CID 87340037
3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoic acid (PubChem CID 87340037) has the molecular formula C12H15F9O2S and a molecular weight of 394.30 g/mol. Its IUPAC name is 3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoic acid.
| Compound Name | 3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 87340037 |
| Molecular Formula | C12H15F9O2S |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoic acid |
| SMILES | CC(C)C(SCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H15F9O2S/c1-6(2)7(8(22)23)24-5-3-4-9(13,14)10(15,16)11(17,18)12(19,20)21/h6-7H,3-5H2,1-2H3,(H,22,23) |
| InChIKey | RDQJDKYDILSQKM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|