About propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate
propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate (PubChem CID 87340042) has the molecular formula C15H28F2O2S
and a molecular weight of 310.45 g/mol. Its IUPAC name is propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate |
| PubChem CID | 87340042 |
| Molecular Formula | C15H28F2O2S |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate |
| SMILES | CCCCC(SCCCCCC(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C15H28F2O2S/c1-4-5-9-13(15(18)19-12(2)3)20-11-8-6-7-10-14(16)17/h12-14H,4-11H2,1-3H3 |
| InChIKey | SSZODTLBZYMBNZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate?
The IUPAC name of propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate (CID 87340042) is propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate.
What is the SMILES notation for propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate?
The canonical SMILES for propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate is CCCCC(SCCCCCC(F)F)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate?
The InChIKey is SSZODTLBZYMBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F2O2S/c1-4-5-9-13(15(18)19-12(2)3)20-11-8-6-7-10-14(16)17/h12-14H,4-11H2,1-3H3.
What are the key properties of propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate?
propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate has a molecular weight of 310.45 g/mol, XLogP of 5.06, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(6,6-difluorohexylsulfanyl)hexanoate is sourced from PubChem (CID 87340042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).