C13H19F7O2S — CID 87340137
methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-4-methylpentanoate (PubChem CID 87340137) has the molecular formula C13H19F7O2S and a molecular weight of 372.35 g/mol. Its IUPAC name is methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-4-methylpentanoate.
| Compound Name | methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 87340137 |
| Molecular Formula | C13H19F7O2S |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)SCCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H19F7O2S/c1-8(2)7-9(10(21)22-3)23-6-4-5-11(14,15)12(16,17)13(18,19)20/h8-9H,4-7H2,1-3H3 |
| InChIKey | FRWYOSLQWABICI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|