About 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid
2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid (PubChem CID 87340192) has the molecular formula C9H16F2O4S
and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid |
| PubChem CID | 87340192 |
| Molecular Formula | C9H16F2O4S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)S(=O)(=O)CCC(F)F |
| InChI | InChI=1S/C9H16F2O4S/c1-9(2,3)7(8(12)13)16(14,15)5-4-6(10)11/h6-7H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | ZLOBZJFZFLFUHW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid?
The IUPAC name of 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid (CID 87340192) is 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid is CC(C)(C)C(C(=O)O)S(=O)(=O)CCC(F)F.
What is the InChIKey of 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid?
The InChIKey is ZLOBZJFZFLFUHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2O4S/c1-9(2,3)7(8(12)13)16(14,15)5-4-6(10)11/h6-7H,4-5H2,1-3H3,(H,12,13).
What are the key properties of 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid?
2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid has a molecular weight of 258.29 g/mol, XLogP of 1.56, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropropylsulfonyl)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 87340192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).