C16H23F9O2S — CID 87340388
propan-2-yl 4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoate (PubChem CID 87340388) has the molecular formula C16H23F9O2S and a molecular weight of 450.41 g/mol. Its IUPAC name is propan-2-yl 4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoate.
| Compound Name | propan-2-yl 4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87340388 |
| Molecular Formula | C16H23F9O2S |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | propan-2-yl 4-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)pentanoate |
| SMILES | CC(C)CC(SCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C16H23F9O2S/c1-9(2)8-11(12(26)27-10(3)4)28-7-5-6-13(17,18)14(19,20)15(21,22)16(23,24)25/h9-11H,5-8H2,1-4H3 |
| InChIKey | JKUDAZUXWFZCDH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|